C15H15F2N3O2 — CID 138495601
N-[3-[5-(3,3-difluorocyclobutyl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]formamide (PubChem CID 138495601) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is N-[3-[5-(3,3-difluorocyclobutyl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]formamide.
| Compound Name | N-[3-[5-(3,3-difluorocyclobutyl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]formamide |
|---|---|
| PubChem CID | 138495601 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[3-[5-(3,3-difluorocyclobutyl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]formamide |
| SMILES | Cc1ccc(-c2noc(C3CC(F)(F)C3)n2)c(C)c1NC=O |
| InChI | InChI=1S/C15H15F2N3O2/c1-8-3-4-11(9(2)12(8)18-7-21)13-19-14(22-20-13)10-5-15(16,17)6-10/h3-4,7,10H,5-6H2,1-2H3,(H,18,21) |
| InChIKey | IKMYWTFVMIDRDX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|