C10H15NO4 — CID 138495613
2-[(3R,4R,5R,7S)-5-ethenyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-7-yl]acetamide (PubChem CID 138495613) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-[(3R,4R,5R,7S)-5-ethenyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-7-yl]acetamide.
| Compound Name | 2-[(3R,4R,5R,7S)-5-ethenyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-7-yl]acetamide |
|---|---|
| PubChem CID | 138495613 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[(3R,4R,5R,7S)-5-ethenyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-7-yl]acetamide |
| SMILES | C=C[C@H]1O[C@H](CC(N)=O)C[C@@]2(CO2)[C@@H]1O |
| InChI | InChI=1S/C10H15NO4/c1-2-7-9(13)10(5-14-10)4-6(15-7)3-8(11)12/h2,6-7,9,13H,1,3-5H2,(H2,11,12)/t6-,7-,9-,10-/m1/s1 |
| InChIKey | HBIGWWPSIFKROU-KHUVANEUSA-N |
| XLogP | -0.66 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|