C19H21ClF2IN3O — CID 138495817
N-[(5-chloro-2-propan-2-ylphenyl)methyl]-N-cyclopropyl-5-fluoro-3-[fluoro(iodo)methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 138495817) has the molecular formula C19H21ClF2IN3O and a molecular weight of 507.75 g/mol. Its IUPAC name is N-[(5-chloro-2-propan-2-ylphenyl)methyl]-N-cyclopropyl-5-fluoro-3-[fluoro(iodo)methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(5-chloro-2-propan-2-ylphenyl)methyl]-N-cyclopropyl-5-fluoro-3-[fluoro(iodo)methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138495817 |
| Molecular Formula | C19H21ClF2IN3O |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | N-[(5-chloro-2-propan-2-ylphenyl)methyl]-N-cyclopropyl-5-fluoro-3-[fluoro(iodo)methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CC(C)c1ccc(Cl)cc1CN(C(=O)c1c(C(F)I)nn(C)c1F)C1CC1 |
| InChI | InChI=1S/C19H21ClF2IN3O/c1-10(2)14-7-4-12(20)8-11(14)9-26(13-5-6-13)19(27)15-16(17(21)23)24-25(3)18(15)22/h4,7-8,10,13,17H,5-6,9H2,1-3H3 |
| InChIKey | IXDXKTHNJMAKHE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|