C26H28N6O2 — CID 138496301
(3E,5E)-5-[12-(aminomethyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-N,4-bis(ethenyl)octa-1,3,5,7-tetraen-3-amine (PubChem CID 138496301) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (3E,5E)-5-[12-(aminomethyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-N,4-bis(ethenyl)octa-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E)-5-[12-(aminomethyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-N,4-bis(ethenyl)octa-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 138496301 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3E,5E)-5-[12-(aminomethyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-N,4-bis(ethenyl)octa-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C=C(C(\C=C)=C(/C=C)NC=C)/c1nc(N2CCOCC2)c2oc3ncc(CN)cc3c2n1 |
| InChI | InChI=1S/C26H28N6O2/c1-5-9-19(18(6-2)21(7-3)28-8-4)24-30-22-20-14-17(15-27)16-29-26(20)34-23(22)25(31-24)32-10-12-33-13-11-32/h5-9,14,16,28H,1-4,10-13,15,27H2/b19-9+,21-18+ |
| InChIKey | ZJQNYXBQOKOEDC-PMQVRXABSA-N |
| XLogP | 3.99 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|