C19H25FO4 — CID 138496308
4-[(3E,4Z)-3-(2-fluoroethylidene)-6-methoxyhexa-1,4-dien-2-yl]-1,2,6-trimethoxycyclohepta-1,3,5-triene (PubChem CID 138496308) has the molecular formula C19H25FO4 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[(3E,4Z)-3-(2-fluoroethylidene)-6-methoxyhexa-1,4-dien-2-yl]-1,2,6-trimethoxycyclohepta-1,3,5-triene.
| Compound Name | 4-[(3E,4Z)-3-(2-fluoroethylidene)-6-methoxyhexa-1,4-dien-2-yl]-1,2,6-trimethoxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 138496308 |
| Molecular Formula | C19H25FO4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[(3E,4Z)-3-(2-fluoroethylidene)-6-methoxyhexa-1,4-dien-2-yl]-1,2,6-trimethoxycyclohepta-1,3,5-triene |
| SMILES | C=C(C1=CC(OC)=C(OC)CC(OC)=C1)C(/C=C\COC)=C/CF |
| InChI | InChI=1S/C19H25FO4/c1-14(15(8-9-20)7-6-10-21-2)16-11-17(22-3)13-19(24-5)18(12-16)23-4/h6-8,11-12H,1,9-10,13H2,2-5H3/b7-6-,15-8+ |
| InChIKey | UEIKMBVKSJNTHV-WLYYOSHGSA-N |
| XLogP | 4.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|