C25H32N4O7 — CID 138496395
tert-butyl N-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate (PubChem CID 138496395) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138496395 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | tert-butyl N-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethoxy]ethyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(C#CCOCCOCCNC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C25H32N4O7/c1-25(2,3)36-23(32)26-12-14-35-16-15-34-13-6-8-17-7-5-9-18-21(17)28(4)24(33)29(18)19-10-11-20(30)27-22(19)31/h5,7,9,19H,10-16H2,1-4H3,(H,26,32)(H,27,30,31) |
| InChIKey | SHNIDPKWAVGNSF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|