C29H44N4O9 — CID 138496397
tert-butyl N-[2-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 138496397) has the molecular formula C29H44N4O9 and a molecular weight of 592.69 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138496397 |
| Molecular Formula | C29H44N4O9 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCOCCOCCOCCOCCNC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C29H44N4O9/c1-29(2,3)42-27(36)30-11-13-39-15-17-41-19-18-40-16-14-38-12-5-6-21-7-8-22-24(20-21)32(4)28(37)33(22)23-9-10-25(34)31-26(23)35/h7-8,20,23H,5-6,9-19H2,1-4H3,(H,30,36)(H,31,34,35) |
| InChIKey | FMONLSATEBTIDW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|