C15H8F2N2O2 — CID 138496482
2,4-difluorospiro[fluorene-9,5'-imidazolidine]-2',4'-dione (PubChem CID 138496482) has the molecular formula C15H8F2N2O2 and a molecular weight of 286.24 g/mol. Its IUPAC name is 2,4-difluorospiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
| Compound Name | 2,4-difluorospiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 138496482 |
| Molecular Formula | C15H8F2N2O2 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2,4-difluorospiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(N1)c1ccccc1-c1c(F)cc(F)cc12 |
| InChI | InChI=1S/C15H8F2N2O2/c16-7-5-10-12(11(17)6-7)8-3-1-2-4-9(8)15(10)13(20)18-14(21)19-15/h1-6H,(H2,18,19,20,21) |
| InChIKey | JVOMTBLPCOZJLL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|