C19H15FN2O2 — CID 138496483
2-fluoro-7-(2-methylcyclopropyl)spiro[fluorene-9,5'-imidazolidine]-2',4'-dione (PubChem CID 138496483) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-fluoro-7-(2-methylcyclopropyl)spiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
| Compound Name | 2-fluoro-7-(2-methylcyclopropyl)spiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 138496483 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-fluoro-7-(2-methylcyclopropyl)spiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| SMILES | CC1CC1c1ccc2c(c1)C1(NC(=O)NC1=O)c1cc(F)ccc1-2 |
| InChI | InChI=1S/C19H15FN2O2/c1-9-6-14(9)10-2-4-12-13-5-3-11(20)8-16(13)19(15(12)7-10)17(23)21-18(24)22-19/h2-5,7-9,14H,6H2,1H3,(H2,21,22,23,24) |
| InChIKey | IRWPQENAVHBDNF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|