About ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate
ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate (PubChem CID 138496534) has the molecular formula C17H20N4O5
and a molecular weight of 360.37 g/mol. Its IUPAC name is ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate |
| PubChem CID | 138496534 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc2c(c1)n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H20N4O5/c1-3-26-16(24)18-9-10-4-5-11-13(8-10)20(2)17(25)21(11)12-6-7-14(22)19-15(12)23/h4-5,8,12H,3,6-7,9H2,1-2H3,(H,18,24)(H,19,22,23) |
| InChIKey | PEXHNNHEJFZNFA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate?
The IUPAC name of ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate (CID 138496534) is ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate.
What is the SMILES notation for ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate?
The canonical SMILES for ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate is CCOC(=O)NCc1ccc2c(c1)n(C)c(=O)n2C1CCC(=O)NC1=O.
What is the InChIKey of ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate?
The InChIKey is PEXHNNHEJFZNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O5/c1-3-26-16(24)18-9-10-4-5-11-13(8-10)20(2)17(25)21(11)12-6-7-14(22)19-15(12)23/h4-5,8,12H,3,6-7,9H2,1-2H3,(H,18,24)(H,19,22,23).
What are the key properties of ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate?
ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate has a molecular weight of 360.37 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]carbamate is sourced from PubChem (CID 138496534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).