C12H21N3O — CID 138497041
1-methoxy-2,2,6,6-tetramethyl-4-(methylideneamino)piperidine-4-carbonitrile (PubChem CID 138497041) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethyl-4-(methylideneamino)piperidine-4-carbonitrile.
| Compound Name | 1-methoxy-2,2,6,6-tetramethyl-4-(methylideneamino)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 138497041 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethyl-4-(methylideneamino)piperidine-4-carbonitrile |
| SMILES | C=NC1(C#N)CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C12H21N3O/c1-10(2)7-12(9-13,14-5)8-11(3,4)15(10)16-6/h5,7-8H2,1-4,6H3 |
| InChIKey | IWSBRKBKOHANDX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|