About [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate
[1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate (PubChem CID 138497206) has the molecular formula C23H26N4O3S
and a molecular weight of 438.55 g/mol. Its IUPAC name is [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate.
Molecular Properties
| Compound Name | [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate |
| PubChem CID | 138497206 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate |
| SMILES | CNC(=O)c1ccc(N2C(=O)CC(S/C(=N/C(C)(C)C)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-23(2,3)26-22(25-16-8-6-5-7-9-16)31-18-14-19(28)27(21(18)30)17-12-10-15(11-13-17)20(29)24-4/h5-13,18H,14H2,1-4H3,(H,24,29)(H,25,26) |
| InChIKey | CJEAKWJJBOEROM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate?
The IUPAC name of [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate (CID 138497206) is [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate.
What is the SMILES notation for [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate?
The canonical SMILES for [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate is CNC(=O)c1ccc(N2C(=O)CC(S/C(=N/C(C)(C)C)Nc3ccccc3)C2=O)cc1.
What is the InChIKey of [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate?
The InChIKey is CJEAKWJJBOEROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O3S/c1-23(2,3)26-22(25-16-8-6-5-7-9-16)31-18-14-19(28)27(21(18)30)17-12-10-15(11-13-17)20(29)24-4/h5-13,18H,14H2,1-4H3,(H,24,29)(H,25,26).
What are the key properties of [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate?
[1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate has a molecular weight of 438.55 g/mol, XLogP of 3.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(methylcarbamoyl)phenyl]-2,5-dioxopyrrolidin-3-yl] N'-tert-butyl-N-phenylcarbamimidothioate is sourced from PubChem (CID 138497206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).