C26H29F3N6S — CID 138497720
4-[2-[2-(1H-indol-5-yl)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 138497720) has the molecular formula C26H29F3N6S and a molecular weight of 514.62 g/mol. Its IUPAC name is 4-[2-[2-(1H-indol-5-yl)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[2-[2-(1H-indol-5-yl)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138497720 |
| Molecular Formula | C26H29F3N6S |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 4-[2-[2-(1H-indol-5-yl)ethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(N2CCC3CN(CCc4ccc5[nH]ccc5c4)CC3C2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C26H29F3N6S/c1-30-25-32-23(21-11-20(12-26(27,28)29)36-24(21)33-25)35-9-6-18-13-34(14-19(18)15-35)8-5-16-2-3-22-17(10-16)4-7-31-22/h2-4,7,10-11,18-19,31H,5-6,8-9,12-15H2,1H3,(H,30,32,33) |
| InChIKey | ALTBRLOYOHKPPU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |