About 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine
4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine (PubChem CID 138497858) has the molecular formula C25H35FN2O
and a molecular weight of 398.57 g/mol. Its IUPAC name is 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine |
| PubChem CID | 138497858 |
| Molecular Formula | C25H35FN2O |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine |
| SMILES | CCCOc1ccc(-c2c(C)nc(C)c(CC)c2N2CCC(C)(C)CC2)cc1F |
| InChI | InChI=1S/C25H35FN2O/c1-7-15-29-22-10-9-19(16-21(22)26)23-18(4)27-17(3)20(8-2)24(23)28-13-11-25(5,6)12-14-28/h9-10,16H,7-8,11-15H2,1-6H3 |
| InChIKey | UQGODXFCOJIBIE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine?
The IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine (CID 138497858) is 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine.
What is the SMILES notation for 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine?
The canonical SMILES for 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine is CCCOc1ccc(-c2c(C)nc(C)c(CC)c2N2CCC(C)(C)CC2)cc1F.
What is the InChIKey of 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine?
The InChIKey is UQGODXFCOJIBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35FN2O/c1-7-15-29-22-10-9-19(16-21(22)26)23-18(4)27-17(3)20(8-2)24(23)28-13-11-25(5,6)12-14-28/h9-10,16H,7-8,11-15H2,1-6H3.
What are the key properties of 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine?
4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine has a molecular weight of 398.57 g/mol, XLogP of 6.48, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpiperidin-1-yl)-3-ethyl-5-(3-fluoro-4-propoxyphenyl)-2,6-dimethylpyridine is sourced from PubChem (CID 138497858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).