C16H11F6NO2S — CID 138498010
N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-fluorophenyl)methyl]benzenesulfonamide (PubChem CID 138498010) has the molecular formula C16H11F6NO2S and a molecular weight of 395.32 g/mol. Its IUPAC name is N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-fluorophenyl)methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138498010 |
| Molecular Formula | C16H11F6NO2S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C16H11F6NO2S/c17-9-3-1-8(2-4-9)7-23(10-5-6-10)26(24,25)16-14(21)12(19)11(18)13(20)15(16)22/h1-4,10H,5-7H2 |
| InChIKey | DZZXVNOYRCYGFH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|