About 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine
1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 138498151) has the molecular formula C18H27N
and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 138498151 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | C=C(C1CC1)N1CCC(C2=C(CC)CCC=C2)CC1 |
| InChI | InChI=1S/C18H27N/c1-3-15-6-4-5-7-18(15)17-10-12-19(13-11-17)14(2)16-8-9-16/h5,7,16-17H,2-4,6,8-13H2,1H3 |
| InChIKey | NNERVSXAWAJLSK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine (CID 138498151) is 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine is C=C(C1CC1)N1CCC(C2=C(CC)CCC=C2)CC1.
What is the InChIKey of 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is NNERVSXAWAJLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N/c1-3-15-6-4-5-7-18(15)17-10-12-19(13-11-17)14(2)16-8-9-16/h5,7,16-17H,2-4,6,8-13H2,1H3.
What are the key properties of 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine?
1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 257.42 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopropylethenyl)-4-(2-ethylcyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 138498151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).