C18H26N2 — CID 138498194
(3Z,5E)-7-[(3E,5Z)-3-methylhepta-3,5-dienyl]imino-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine (PubChem CID 138498194) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (3Z,5E)-7-[(3E,5Z)-3-methylhepta-3,5-dienyl]imino-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-7-[(3E,5Z)-3-methylhepta-3,5-dienyl]imino-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 138498194 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (3Z,5E)-7-[(3E,5Z)-3-methylhepta-3,5-dienyl]imino-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(C)NC(=C)/C=C\C=C\C=N\CC/C(C)=C/C=C\C |
| InChI | InChI=1S/C18H26N2/c1-6-7-11-17(4)13-15-19-14-10-8-9-12-18(5)20-16(2)3/h6-12,14,20H,2,5,13,15H2,1,3-4H3/b7-6-,10-8+,12-9-,17-11+,19-14+ |
| InChIKey | PURBYRMNZYFDSA-SLXNMXBISA-N |
| XLogP | 4.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|