C24H34N2 — CID 138498288
2-[(3Z,5E)-6,7-dimethylnona-1,3,5-trien-2-yl]-N-(4-ethenylhexa-3,5-dien-3-yl)-1H-pyridin-2-amine (PubChem CID 138498288) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-[(3Z,5E)-6,7-dimethylnona-1,3,5-trien-2-yl]-N-(4-ethenylhexa-3,5-dien-3-yl)-1H-pyridin-2-amine.
| Compound Name | 2-[(3Z,5E)-6,7-dimethylnona-1,3,5-trien-2-yl]-N-(4-ethenylhexa-3,5-dien-3-yl)-1H-pyridin-2-amine |
|---|---|
| PubChem CID | 138498288 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2-[(3Z,5E)-6,7-dimethylnona-1,3,5-trien-2-yl]-N-(4-ethenylhexa-3,5-dien-3-yl)-1H-pyridin-2-amine |
| SMILES | C=CC(C=C)=C(CC)NC1(C(=C)/C=C\C=C(/C)C(C)CC)C=CC=CN1 |
| InChI | InChI=1S/C24H34N2/c1-8-19(5)20(6)15-14-16-21(7)24(17-12-13-18-25-24)26-23(11-4)22(9-2)10-3/h9-10,12-19,25-26H,2-3,7-8,11H2,1,4-6H3/b16-14-,20-15+ |
| InChIKey | QYAUZLZADQOROW-NVVUQHMZSA-N |
| XLogP | 6.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|