C69H41F6N3 — CID 138499752
3-[4-[2,6-bis(trifluoromethyl)phenyl]-2-(3,6-diphenylcarbazol-9-yl)phenyl]-4-(3,6-diphenylcarbazol-9-yl)benzonitrile (PubChem CID 138499752) has the molecular formula C69H41F6N3 and a molecular weight of 1026.10 g/mol. Its IUPAC name is 3-[4-[2,6-bis(trifluoromethyl)phenyl]-2-(3,6-diphenylcarbazol-9-yl)phenyl]-4-(3,6-diphenylcarbazol-9-yl)benzonitrile.
| Compound Name | 3-[4-[2,6-bis(trifluoromethyl)phenyl]-2-(3,6-diphenylcarbazol-9-yl)phenyl]-4-(3,6-diphenylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 138499752 |
| Molecular Formula | C69H41F6N3 |
| Molecular Weight | 1026.10 g/mol |
| Exact Mass | 1025.32 |
| IUPAC Name | 3-[4-[2,6-bis(trifluoromethyl)phenyl]-2-(3,6-diphenylcarbazol-9-yl)phenyl]-4-(3,6-diphenylcarbazol-9-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c(-c2ccc(-c3c(C(F)(F)F)cccc3C(F)(F)F)cc2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C69H41F6N3/c70-68(71,72)59-22-13-23-60(69(73,74)75)67(59)52-25-30-53(66(41-52)78-64-34-28-50(46-18-9-3-10-19-46)39-57(64)58-40-51(29-35-65(58)78)47-20-11-4-12-21-47)54-36-43(42-76)24-31-61(54)77-62-32-26-48(44-14-5-1-6-15-44)37-55(62)56-38-49(27-33-63(56)77)45-16-7-2-8-17-45/h1-41H |
| InChIKey | UOKXTQJDVRJGTF-UHFFFAOYSA-N |
| XLogP | 19.79 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.10 |
| LogP ≤ 5 | 19.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |