C28H30N8O2 — CID 138500207
3-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]amino]-N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]benzamide (PubChem CID 138500207) has the molecular formula C28H30N8O2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 3-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]amino]-N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]benzamide.
| Compound Name | 3-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]amino]-N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 138500207 |
| Molecular Formula | C28H30N8O2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]amino]-N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]benzamide |
| SMILES | CN(C)C/C=C/C(O)Nc1cccc(C(=O)NCCc2cc3c(-c4cnn5ncccc45)ccnc3[nH]2)c1 |
| InChI | InChI=1S/C28H30N8O2/c1-35(2)15-5-9-26(37)33-20-7-3-6-19(16-20)28(38)30-13-10-21-17-23-22(11-14-29-27(23)34-21)24-18-32-36-25(24)8-4-12-31-36/h3-9,11-12,14,16-18,26,33,37H,10,13,15H2,1-2H3,(H,29,34)(H,30,38)/b9-5+ |
| InChIKey | PJLLXSOHDWYPRB-WEVVVXLNSA-N |
| XLogP | 3.09 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|