C20H17F6IO9S — CID 138500321
3,3,3-trifluoro-2-[3-[hydroxy-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methoxy]-4-iodobenzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 138500321) has the molecular formula C20H17F6IO9S and a molecular weight of 674.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[3-[hydroxy-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methoxy]-4-iodobenzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[3-[hydroxy-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methoxy]-4-iodobenzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 138500321 |
| Molecular Formula | C20H17F6IO9S |
| Molecular Weight | 674.31 g/mol |
| Exact Mass | 673.95 |
| IUPAC Name | 3,3,3-trifluoro-2-[3-[hydroxy-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methoxy]-4-iodobenzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c1ccc(I)c(OC(O)C2C3CC4OC(=O)C2C4C3)c1 |
| InChI | InChI=1S/C20H17F6IO9S/c21-19(22,23)18(20(24,25)26,6-37(31,32)33)36-15(28)7-1-2-10(27)12(4-7)35-16(29)13-8-3-9-11(5-8)34-17(30)14(9)13/h1-2,4,8-9,11,13-14,16,29H,3,5-6H2,(H,31,32,33) |
| InChIKey | RGVRWSYQKANPKF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|