C37H30N4OS — CID 138500446
2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile (PubChem CID 138500446) has the molecular formula C37H30N4OS and a molecular weight of 578.74 g/mol. Its IUPAC name is 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500446 |
| Molecular Formula | C37H30N4OS |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(/C=C/c2cc3c(s2)-c2cnc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc2C3(C)C)O1 |
| InChI | InChI=1S/C37H30N4OS/c1-23-6-10-28(11-7-23)41(29-12-8-24(2)9-13-29)35-19-33-32(22-40-35)36-34(37(33,4)5)18-31(43-36)15-14-30-17-26(16-25(3)42-30)27(20-38)21-39/h6-19,22H,1-5H3/b15-14+ |
| InChIKey | MVVMOQVAQWUJQW-CCEZHUSRSA-N |
| XLogP | 9.71 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|