C45H28N2O2S — CID 138500463
2-[[6'-(N-(6-methyl-3-pyridinyl)anilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]indene-1,3-dione (PubChem CID 138500463) has the molecular formula C45H28N2O2S and a molecular weight of 660.80 g/mol. Its IUPAC name is 2-[[6'-(N-(6-methyl-3-pyridinyl)anilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[6'-(N-(6-methyl-3-pyridinyl)anilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 138500463 |
| Molecular Formula | C45H28N2O2S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 2-[[6'-(N-(6-methyl-3-pyridinyl)anilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]indene-1,3-dione |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2cc(C=C4C(=O)c5ccccc5C4=O)sc2-3)cn1 |
| InChI | InChI=1S/C45H28N2O2S/c1-27-19-20-30(26-46-27)47(28-11-3-2-4-12-28)29-21-22-36-40(23-29)45(38-17-9-7-13-32(38)33-14-8-10-18-39(33)45)41-25-31(50-44(36)41)24-37-42(48)34-15-5-6-16-35(34)43(37)49/h2-26H,1H3 |
| InChIKey | DLRGRGWOSHOKCN-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|