C40H32N2OS — CID 138500566
(2Z)-2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]-3,3-dimethylinden-1-one (PubChem CID 138500566) has the molecular formula C40H32N2OS and a molecular weight of 588.78 g/mol. Its IUPAC name is (2Z)-2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]-3,3-dimethylinden-1-one.
| Compound Name | (2Z)-2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]-3,3-dimethylinden-1-one |
|---|---|
| PubChem CID | 138500566 |
| Molecular Formula | C40H32N2OS |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | (2Z)-2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]-3,3-dimethylinden-1-one |
| SMILES | CC1(C)/C(=C/c2cc3c(s2)-c2ccc(N(c4ccccc4)c4cnc5ccccc5c4)cc2C3(C)C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C40H32N2OS/c1-39(2)32-16-10-9-15-30(32)37(43)34(39)22-29-23-35-38(44-29)31-19-18-27(21-33(31)40(35,3)4)42(26-13-6-5-7-14-26)28-20-25-12-8-11-17-36(25)41-24-28/h5-24H,1-4H3/b34-22+ |
| InChIKey | MFCOHFHEUVYKHJ-PPOKSSTKSA-N |
| XLogP | 10.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|