C38H26N2O2S — CID 138500575
2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 138500575) has the molecular formula C38H26N2O2S and a molecular weight of 574.71 g/mol. Its IUPAC name is 2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 138500575 |
| Molecular Formula | C38H26N2O2S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[[4,4-dimethyl-6-(N-quinolin-3-ylanilino)indeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3cnc4ccccc4c3)ccc2-c2sc(C=C3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C38H26N2O2S/c1-38(2)32-19-25(40(24-11-4-3-5-12-24)26-18-23-10-6-9-15-34(23)39-22-26)16-17-30(32)37-33(38)21-27(43-37)20-31-35(41)28-13-7-8-14-29(28)36(31)42/h3-22H,1-2H3 |
| InChIKey | XJQHBSWLBYIEFK-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|