C37H31N3O2S — CID 138500603
(6E)-6-[[6-(N-(6-tert-butyl-3-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]cyclopenta[b]pyridine-5,7-dione (PubChem CID 138500603) has the molecular formula C37H31N3O2S and a molecular weight of 581.74 g/mol. Its IUPAC name is (6E)-6-[[6-(N-(6-tert-butyl-3-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]cyclopenta[b]pyridine-5,7-dione.
| Compound Name | (6E)-6-[[6-(N-(6-tert-butyl-3-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]cyclopenta[b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 138500603 |
| Molecular Formula | C37H31N3O2S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (6E)-6-[[6-(N-(6-tert-butyl-3-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]cyclopenta[b]pyridine-5,7-dione |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc(/C=C4\C(=O)c5cccnc5C4=O)sc2-3)cn1 |
| InChI | InChI=1S/C37H31N3O2S/c1-36(2,3)31-16-14-24(21-39-31)40(22-10-7-6-8-11-22)23-13-15-26-29(18-23)37(4,5)30-20-25(43-35(26)30)19-28-33(41)27-12-9-17-38-32(27)34(28)42/h6-21H,1-5H3/b28-19+ |
| InChIKey | JXGCBPUTGKMRFN-TURZUDJPSA-N |
| XLogP | 9.07 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|