C42H24N2O2S2 — CID 138500652
5-[[10-(N-phenylanilino)spiro[3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-7,9'-fluorene]-4-yl]methylidene]cyclopenta[c]thiophene-4,6-dione (PubChem CID 138500652) has the molecular formula C42H24N2O2S2 and a molecular weight of 652.80 g/mol. Its IUPAC name is 5-[[10-(N-phenylanilino)spiro[3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-7,9'-fluorene]-4-yl]methylidene]cyclopenta[c]thiophene-4,6-dione.
| Compound Name | 5-[[10-(N-phenylanilino)spiro[3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-7,9'-fluorene]-4-yl]methylidene]cyclopenta[c]thiophene-4,6-dione |
|---|---|
| PubChem CID | 138500652 |
| Molecular Formula | C42H24N2O2S2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 5-[[10-(N-phenylanilino)spiro[3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-7,9'-fluorene]-4-yl]methylidene]cyclopenta[c]thiophene-4,6-dione |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2ncc(N(c4ccccc4)c4ccccc4)cc2C32c3ccccc3-c3ccccc32)C(=O)c2cscc21 |
| InChI | InChI=1S/C42H24N2O2S2/c45-39-31(40(46)33-24-47-23-32(33)39)20-28-21-37-41(48-28)38-36(42(37)34-17-9-7-15-29(34)30-16-8-10-18-35(30)42)19-27(22-43-38)44(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-24H |
| InChIKey | HEBLJDPFFRRMAN-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|