C42H32N4OS — CID 138500708
2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile (PubChem CID 138500708) has the molecular formula C42H32N4OS and a molecular weight of 640.81 g/mol. Its IUPAC name is 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500708 |
| Molecular Formula | C42H32N4OS |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 2-[2-[(E)-2-[7,7-dimethyl-10-(4-methyl-N-(4-methylphenyl)anilino)-3-thia-11-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-4-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc3c(cn2)-c2sc(/C=C/C4=CC(=C(C#N)C#N)C=C(c5ccccc5)O4)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C42H32N4OS/c1-27-10-14-32(15-11-27)46(33-16-12-28(2)13-17-33)40-23-37-36(26-45-40)41-38(42(37,3)4)22-35(48-41)19-18-34-20-30(31(24-43)25-44)21-39(47-34)29-8-6-5-7-9-29/h5-23,26H,1-4H3/b19-18+ |
| InChIKey | SYBXJRGCVXRADO-VHEBQXMUSA-N |
| XLogP | 10.85 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|