C21H20F3N3O3 — CID 138501191
methyl 5-cyclopropyl-2-[(2-methyl-1H-indol-5-yl)-(2,2,2-trifluoro-1-hydroxyethyl)amino]pyridine-3-carboxylate (PubChem CID 138501191) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-[(2-methyl-1H-indol-5-yl)-(2,2,2-trifluoro-1-hydroxyethyl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 5-cyclopropyl-2-[(2-methyl-1H-indol-5-yl)-(2,2,2-trifluoro-1-hydroxyethyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 138501191 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | methyl 5-cyclopropyl-2-[(2-methyl-1H-indol-5-yl)-(2,2,2-trifluoro-1-hydroxyethyl)amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C2CC2)cnc1N(c1ccc2[nH]c(C)cc2c1)C(O)C(F)(F)F |
| InChI | InChI=1S/C21H20F3N3O3/c1-11-7-13-8-15(5-6-17(13)26-11)27(20(29)21(22,23)24)18-16(19(28)30-2)9-14(10-25-18)12-3-4-12/h5-10,12,20,26,29H,3-4H2,1-2H3 |
| InChIKey | QTECQKSWBZGBQM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|