C22H30N8O4 — CID 138501403
(E)-3-[[amino-(methylideneamino)methylidene]amino]-N-[8-[3-(2-hydroxyethylamino)propoxy]-7-methoxy-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-ylidene]-2-methylprop-2-enamide (PubChem CID 138501403) has the molecular formula C22H30N8O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is (E)-3-[[amino-(methylideneamino)methylidene]amino]-N-[8-[3-(2-hydroxyethylamino)propoxy]-7-methoxy-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-ylidene]-2-methylprop-2-enamide.
| Compound Name | (E)-3-[[amino-(methylideneamino)methylidene]amino]-N-[8-[3-(2-hydroxyethylamino)propoxy]-7-methoxy-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-ylidene]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 138501403 |
| Molecular Formula | C22H30N8O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | (E)-3-[[amino-(methylideneamino)methylidene]amino]-N-[8-[3-(2-hydroxyethylamino)propoxy]-7-methoxy-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-ylidene]-2-methylprop-2-enamide |
| SMILES | C=N/C(N)=N\C=C(/C)C(=O)/N=c1\nc2c(OC)c(OCCCNCCO)ccc2c2n1CCN2 |
| InChI | InChI=1S/C22H30N8O4/c1-14(13-27-21(23)24-2)20(32)29-22-28-17-15(19-26-8-10-30(19)22)5-6-16(18(17)33-3)34-12-4-7-25-9-11-31/h5-6,13,25-26,31H,2,4,7-12H2,1,3H3,(H2,23,27)/b14-13+,29-22+ |
| InChIKey | XOUYYOCPNLFXKF-FDIRUVDZSA-N |
| XLogP | 0.17 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|