C21H26N6O — CID 138501488
[4-(4-methylpiperazin-1-yl)-6-[[methyl(quinolin-8-yl)amino]methyl]pyrimidin-2-yl]methanol (PubChem CID 138501488) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)-6-[[methyl(quinolin-8-yl)amino]methyl]pyrimidin-2-yl]methanol.
| Compound Name | [4-(4-methylpiperazin-1-yl)-6-[[methyl(quinolin-8-yl)amino]methyl]pyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 138501488 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)-6-[[methyl(quinolin-8-yl)amino]methyl]pyrimidin-2-yl]methanol |
| SMILES | CN1CCN(c2cc(CN(C)c3cccc4cccnc34)nc(CO)n2)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-25-9-11-27(12-10-25)20-13-17(23-19(15-28)24-20)14-26(2)18-7-3-5-16-6-4-8-22-21(16)18/h3-8,13,28H,9-12,14-15H2,1-2H3 |
| InChIKey | GAKGXWMRSDCWHE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |