C36H66N6 — CID 138501692
N'-[(7E,9E)-11,12,12-trimethyl-9-[5-methyl-4-[(E)-2-(4-methylpiperazin-1-yl)but-2-enyl]-4,5-dihydro-1H-imidazol-2-yl]-7-propan-2-yltrideca-1,7,9-trien-2-yl]butane-1,4-diamine (PubChem CID 138501692) has the molecular formula C36H66N6 and a molecular weight of 582.97 g/mol. Its IUPAC name is N'-[(7E,9E)-11,12,12-trimethyl-9-[5-methyl-4-[(E)-2-(4-methylpiperazin-1-yl)but-2-enyl]-4,5-dihydro-1H-imidazol-2-yl]-7-propan-2-yltrideca-1,7,9-trien-2-yl]butane-1,4-diamine.
| Compound Name | N'-[(7E,9E)-11,12,12-trimethyl-9-[5-methyl-4-[(E)-2-(4-methylpiperazin-1-yl)but-2-enyl]-4,5-dihydro-1H-imidazol-2-yl]-7-propan-2-yltrideca-1,7,9-trien-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 138501692 |
| Molecular Formula | C36H66N6 |
| Molecular Weight | 582.97 g/mol |
| Exact Mass | 582.53 |
| IUPAC Name | N'-[(7E,9E)-11,12,12-trimethyl-9-[5-methyl-4-[(E)-2-(4-methylpiperazin-1-yl)but-2-enyl]-4,5-dihydro-1H-imidazol-2-yl]-7-propan-2-yltrideca-1,7,9-trien-2-yl]butane-1,4-diamine |
| SMILES | C=C(CCCC/C(=C\C(=C/C(C)C(C)(C)C)C1=NC(C/C(=C\C)N2CCN(C)CC2)C(C)N1)C(C)C)NCCCCN |
| InChI | InChI=1S/C36H66N6/c1-11-33(42-22-20-41(10)21-23-42)26-34-30(6)39-35(40-34)32(24-28(4)36(7,8)9)25-31(27(2)3)17-13-12-16-29(5)38-19-15-14-18-37/h11,24-25,27-28,30,34,38H,5,12-23,26,37H2,1-4,6-10H3,(H,39,40)/b31-25+,32-24+,33-11+ |
| InChIKey | UMYOEFNDWPFQLH-KFKCMRKKSA-N |
| XLogP | 6.88 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.97 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|