About 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine
1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine (PubChem CID 138501761) has the molecular formula C11H13Br2N
and a molecular weight of 319.04 g/mol. Its IUPAC name is 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine.
Molecular Properties
| Compound Name | 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine |
| PubChem CID | 138501761 |
| Molecular Formula | C11H13Br2N |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine |
| SMILES | C=CC1=CCCC(CBr)=CN1C(=C)Br |
| InChI | InChI=1S/C11H13Br2N/c1-3-11-6-4-5-10(7-12)8-14(11)9(2)13/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | PYDKNXGCLSNYIL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine?
The IUPAC name of 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine (CID 138501761) is 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine.
What is the SMILES notation for 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine?
The canonical SMILES for 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine is C=CC1=CCCC(CBr)=CN1C(=C)Br.
What is the InChIKey of 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine?
The InChIKey is PYDKNXGCLSNYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Br2N/c1-3-11-6-4-5-10(7-12)8-14(11)9(2)13/h3,6,8H,1-2,4-5,7H2.
What are the key properties of 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine?
1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine has a molecular weight of 319.04 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-bromoethenyl)-6-(bromomethyl)-2-ethenyl-4,5-dihydroazepine is sourced from PubChem (CID 138501761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).