C22H32O2S3 — CID 138501816
(13'S)-13'-ethyl-11'-hydroxy-11'-(sulfanylmethyl)spiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 138501816) has the molecular formula C22H32O2S3 and a molecular weight of 424.70 g/mol. Its IUPAC name is (13'S)-13'-ethyl-11'-hydroxy-11'-(sulfanylmethyl)spiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (13'S)-13'-ethyl-11'-hydroxy-11'-(sulfanylmethyl)spiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 138501816 |
| Molecular Formula | C22H32O2S3 |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (13'S)-13'-ethyl-11'-hydroxy-11'-(sulfanylmethyl)spiro[1,3-dithiolane-2,3'-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CC[C@]12CC(O)(CS)C3C4CCC5(C=C4CCC3C1CCC2=O)SCCS5 |
| InChI | InChI=1S/C22H32O2S3/c1-2-20-12-21(24,13-25)19-15-7-8-22(26-9-10-27-22)11-14(15)3-4-16(19)17(20)5-6-18(20)23/h11,15-17,19,24-25H,2-10,12-13H2,1H3/t15?,16?,17?,19?,20-,21?/m0/s1 |
| InChIKey | WYGJFPXZGRKUKI-WUYDXNIYSA-N |
| XLogP | 4.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|