C11H16F3NO — CID 138502475
2,2,2-trifluoro-N-[(3E,5E)-6-methylocta-3,5-dien-4-yl]acetamide (PubChem CID 138502475) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3E,5E)-6-methylocta-3,5-dien-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3E,5E)-6-methylocta-3,5-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 138502475 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3E,5E)-6-methylocta-3,5-dien-4-yl]acetamide |
| SMILES | CC/C=C(\C=C(/C)CC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO/c1-4-6-9(7-8(3)5-2)15-10(16)11(12,13)14/h6-7H,4-5H2,1-3H3,(H,15,16)/b8-7+,9-6+ |
| InChIKey | IUFDJEJAKLDVBN-KHHFIZIMSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|