C20H21NO3S2 — CID 138502499
6-[4-(3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenoxy]hexane-1,1-diol (PubChem CID 138502499) has the molecular formula C20H21NO3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-[4-(3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenoxy]hexane-1,1-diol.
| Compound Name | 6-[4-(3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenoxy]hexane-1,1-diol |
|---|---|
| PubChem CID | 138502499 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 6-[4-(3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenoxy]hexane-1,1-diol |
| SMILES | OC(O)CCCCCOc1ccc(-n2c3ccsc3c3sccc32)cc1 |
| InChI | InChI=1S/C20H21NO3S2/c22-18(23)4-2-1-3-11-24-15-7-5-14(6-8-15)21-16-9-12-25-19(16)20-17(21)10-13-26-20/h5-10,12-13,18,22-23H,1-4,11H2 |
| InChIKey | OBJKTRNNIRSYIB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|