About CID 138502844
CID 138502844 (PubChem CID 138502844) has the molecular formula C26H37N5O4
and a molecular weight of 483.61 g/mol.
Molecular Properties
| Compound Name | CID 138502844 |
| PubChem CID | 138502844 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | — |
| SMILES | CC1CCC2(CC1)NC(=O)C(C)(C)C(=O)NC1(CCCCC1)C(=O)Nc1ccc(N)cc1NC2=O |
| InChI | InChI=1S/C26H37N5O4/c1-16-9-13-26(14-10-16)23(35)29-19-15-17(27)7-8-18(19)28-22(34)25(11-5-4-6-12-25)30-20(32)24(2,3)21(33)31-26/h7-8,15-16H,4-6,9-14,27H2,1-3H3,(H,28,34)(H,29,35)(H,30,32)(H,31,33) |
| InChIKey | JIZQIMFNSPCCBC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 138502844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138502844?
The IUPAC name of CID 138502844 (CID 138502844) is not available.
What is the SMILES notation for CID 138502844?
The canonical SMILES for CID 138502844 is CC1CCC2(CC1)NC(=O)C(C)(C)C(=O)NC1(CCCCC1)C(=O)Nc1ccc(N)cc1NC2=O.
What is the InChIKey of CID 138502844?
The InChIKey is JIZQIMFNSPCCBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37N5O4/c1-16-9-13-26(14-10-16)23(35)29-19-15-17(27)7-8-18(19)28-22(34)25(11-5-4-6-12-25)30-20(32)24(2,3)21(33)31-26/h7-8,15-16H,4-6,9-14,27H2,1-3H3,(H,28,34)(H,29,35)(H,30,32)(H,31,33).
What are the key properties of CID 138502844?
CID 138502844 has a molecular weight of 483.61 g/mol, XLogP of 3.07, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138502844 is sourced from PubChem (CID 138502844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).