About N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide
N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide (PubChem CID 138502884) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide |
| PubChem CID | 138502884 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide |
| SMILES | CCC(C)(C)/C=C/CNC(=O)COC |
| InChI | InChI=1S/C11H21NO2/c1-5-11(2,3)7-6-8-12-10(13)9-14-4/h6-7H,5,8-9H2,1-4H3,(H,12,13)/b7-6+ |
| InChIKey | ICIOSQHLYYACEF-VOTSOKGWSA-N |
| XLogP | 1.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide?
The IUPAC name of N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide (CID 138502884) is N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide.
What is the SMILES notation for N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide?
The canonical SMILES for N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide is CCC(C)(C)/C=C/CNC(=O)COC.
What is the InChIKey of N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide?
The InChIKey is ICIOSQHLYYACEF-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H21NO2/c1-5-11(2,3)7-6-8-12-10(13)9-14-4/h6-7H,5,8-9H2,1-4H3,(H,12,13)/b7-6+.
What are the key properties of N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide?
N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide has a molecular weight of 199.29 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-4,4-dimethylhex-2-enyl]-2-methoxyacetamide is sourced from PubChem (CID 138502884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).