C30H28ClN5O2 — CID 138502934
[(3R)-3-aminopiperidin-1-yl]-[2-[1-[(4-chlorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 138502934) has the molecular formula C30H28ClN5O2 and a molecular weight of 526.04 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(4-chlorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(4-chlorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 138502934 |
| Molecular Formula | C30H28ClN5O2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(4-chlorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | N[C@@H]1CCCN(C(=O)c2cc3c4c(c2)nc(-c2cc5ccccc5n2Cc2ccc(Cl)cc2)n4CCO3)C1 |
| InChI | InChI=1S/C30H28ClN5O2/c31-22-9-7-19(8-10-22)17-36-25-6-2-1-4-20(25)15-26(36)29-33-24-14-21(16-27-28(24)35(29)12-13-38-27)30(37)34-11-3-5-23(32)18-34/h1-2,4,6-10,14-16,23H,3,5,11-13,17-18,32H2/t23-/m1/s1 |
| InChIKey | YTWWPSKDZIWWGS-HSZRJFAPSA-N |
| XLogP | 5.32 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |