About 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol
2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol (PubChem CID 138502967) has the molecular formula C8H16N2OS
and a molecular weight of 188.30 g/mol. Its IUPAC name is 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol.
Molecular Properties
| Compound Name | 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol |
| PubChem CID | 138502967 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol |
| SMILES | C[C@H]1COC(NC(C)(C)CS)=N1 |
| InChI | InChI=1S/C8H16N2OS/c1-6-4-11-7(9-6)10-8(2,3)5-12/h6,12H,4-5H2,1-3H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | DSGXJTIKYIAEKZ-LURJTMIESA-N |
| XLogP | 1.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol?
The IUPAC name of 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol (CID 138502967) is 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol.
What is the SMILES notation for 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol?
The canonical SMILES for 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol is C[C@H]1COC(NC(C)(C)CS)=N1.
What is the InChIKey of 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol?
The InChIKey is DSGXJTIKYIAEKZ-LURJTMIESA-N. The full InChI is InChI=1S/C8H16N2OS/c1-6-4-11-7(9-6)10-8(2,3)5-12/h6,12H,4-5H2,1-3H3,(H,9,10)/t6-/m0/s1.
What are the key properties of 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol?
2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol has a molecular weight of 188.30 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-1-thiol is sourced from PubChem (CID 138502967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).