C8H14N2 — CID 138503022
(1Z)-1-N-ethenyl-1-N,3-N-dimethylbuta-1,3-diene-1,3-diamine (PubChem CID 138503022) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1Z)-1-N-ethenyl-1-N,3-N-dimethylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-1-N-ethenyl-1-N,3-N-dimethylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 138503022 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1Z)-1-N-ethenyl-1-N,3-N-dimethylbuta-1,3-diene-1,3-diamine |
| SMILES | C=CN(C)/C=C\C(=C)NC |
| InChI | InChI=1S/C8H14N2/c1-5-10(4)7-6-8(2)9-3/h5-7,9H,1-2H2,3-4H3/b7-6- |
| InChIKey | FOZBCEDVQRQGEP-SREVYHEPSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|