About 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine
4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine (PubChem CID 138503036) has the molecular formula C24H48N2O
and a molecular weight of 380.66 g/mol. Its IUPAC name is 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine |
| PubChem CID | 138503036 |
| Molecular Formula | C24H48N2O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.38 |
| IUPAC Name | 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine |
| SMILES | CC(C)C1CCC(C(C)(C)CCC(C)(C)C2CN(C(C)(C)C)CCO2)NC1 |
| InChI | InChI=1S/C24H48N2O/c1-18(2)19-10-11-20(25-16-19)23(6,7)12-13-24(8,9)21-17-26(14-15-27-21)22(3,4)5/h18-21,25H,10-17H2,1-9H3 |
| InChIKey | RVQZGZSAZTWJPY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine?
The IUPAC name of 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine (CID 138503036) is 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine.
What is the SMILES notation for 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine?
The canonical SMILES for 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine is CC(C)C1CCC(C(C)(C)CCC(C)(C)C2CN(C(C)(C)C)CCO2)NC1.
What is the InChIKey of 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine?
The InChIKey is RVQZGZSAZTWJPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48N2O/c1-18(2)19-10-11-20(25-16-19)23(6,7)12-13-24(8,9)21-17-26(14-15-27-21)22(3,4)5/h18-21,25H,10-17H2,1-9H3.
What are the key properties of 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine?
4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine has a molecular weight of 380.66 g/mol, XLogP of 5.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[2,5-dimethyl-5-(5-propan-2-ylpiperidin-2-yl)hexan-2-yl]morpholine is sourced from PubChem (CID 138503036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).