C30H28FN5O2 — CID 138503118
[(3R)-3-aminopiperidin-1-yl]-[2-[1-[(2-fluorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 138503118) has the molecular formula C30H28FN5O2 and a molecular weight of 509.59 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(2-fluorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(2-fluorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 138503118 |
| Molecular Formula | C30H28FN5O2 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-[(2-fluorophenyl)methyl]indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | N[C@@H]1CCCN(C(=O)c2cc3c4c(c2)nc(-c2cc5ccccc5n2Cc2ccccc2F)n4CCO3)C1 |
| InChI | InChI=1S/C30H28FN5O2/c31-23-9-3-1-7-20(23)17-36-25-10-4-2-6-19(25)15-26(36)29-33-24-14-21(16-27-28(24)35(29)12-13-38-27)30(37)34-11-5-8-22(32)18-34/h1-4,6-7,9-10,14-16,22H,5,8,11-13,17-18,32H2/t22-/m1/s1 |
| InChIKey | INNIPFBUZSIMHT-JOCHJYFZSA-N |
| XLogP | 4.80 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |