C15H17N — CID 138503156
1-(cyclopropylmethyl)-2-ethenyl-7-methylindole (PubChem CID 138503156) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-ethenyl-7-methylindole.
| Compound Name | 1-(cyclopropylmethyl)-2-ethenyl-7-methylindole |
|---|---|
| PubChem CID | 138503156 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-ethenyl-7-methylindole |
| SMILES | C=Cc1cc2cccc(C)c2n1CC1CC1 |
| InChI | InChI=1S/C15H17N/c1-3-14-9-13-6-4-5-11(2)15(13)16(14)10-12-7-8-12/h3-6,9,12H,1,7-8,10H2,2H3 |
| InChIKey | LWHXEJSAMGTUPD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |