C14H18Cl2N4 — CID 138503187
N-[(8-amino-5,6-dichloroquinolin-2-yl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 138503187) has the molecular formula C14H18Cl2N4 and a molecular weight of 313.23 g/mol. Its IUPAC name is N-[(8-amino-5,6-dichloroquinolin-2-yl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(8-amino-5,6-dichloroquinolin-2-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 138503187 |
| Molecular Formula | C14H18Cl2N4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[(8-amino-5,6-dichloroquinolin-2-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccc2c(Cl)c(Cl)cc(N)c2n1 |
| InChI | InChI=1S/C14H18Cl2N4/c1-20(2)6-5-18-8-9-3-4-10-13(16)11(15)7-12(17)14(10)19-9/h3-4,7,18H,5-6,8,17H2,1-2H3 |
| InChIKey | YKQLYELMQIKGJC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|