C29H29N7O — CID 138503211
[(3R)-3-aminopiperidin-1-yl]-[2-[1-(pyridin-3-ylmethyl)indol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 138503211) has the molecular formula C29H29N7O and a molecular weight of 491.60 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-[1-(pyridin-3-ylmethyl)indol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-(pyridin-3-ylmethyl)indol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 138503211 |
| Molecular Formula | C29H29N7O |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-(pyridin-3-ylmethyl)indol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | N[C@@H]1CCCN(C(=O)c2cc3c4c(c2)nc(-c2cc5ccccc5n2Cc2cccnc2)n4CCN3)C1 |
| InChI | InChI=1S/C29H29N7O/c30-22-7-4-11-34(18-22)29(37)21-13-23-27-24(14-21)33-28(35(27)12-10-32-23)26-15-20-6-1-2-8-25(20)36(26)17-19-5-3-9-31-16-19/h1-3,5-6,8-9,13-16,22,32H,4,7,10-12,17-18,30H2/t22-/m1/s1 |
| InChIKey | ZVYWQARDVBIPNE-JOCHJYFZSA-N |
| XLogP | 4.09 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |