C24H24N4O4S — CID 138503233
methyl 2-[1-(cyclopropylmethyl)indol-2-yl]-9-methylsulfonyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate (PubChem CID 138503233) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is methyl 2-[1-(cyclopropylmethyl)indol-2-yl]-9-methylsulfonyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate.
| Compound Name | methyl 2-[1-(cyclopropylmethyl)indol-2-yl]-9-methylsulfonyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 138503233 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 2-[1-(cyclopropylmethyl)indol-2-yl]-9-methylsulfonyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
| SMILES | COC(=O)c1cc2c3c(c1)nc(-c1cc4ccccc4n1CC1CC1)n3CCN2S(C)(=O)=O |
| InChI | InChI=1S/C24H24N4O4S/c1-32-24(29)17-11-18-22-20(13-17)28(33(2,30)31)10-9-26(22)23(25-18)21-12-16-5-3-4-6-19(16)27(21)14-15-7-8-15/h3-6,11-13,15H,7-10,14H2,1-2H3 |
| InChIKey | YTNOZLXUKPRAIR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |