C26H19F3N2O3 — CID 138503537
3-[8-[[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]methyl]isoquinolin-5-yl]benzoic acid (PubChem CID 138503537) has the molecular formula C26H19F3N2O3 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3-[8-[[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]methyl]isoquinolin-5-yl]benzoic acid.
| Compound Name | 3-[8-[[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]methyl]isoquinolin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 138503537 |
| Molecular Formula | C26H19F3N2O3 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 3-[8-[[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]methyl]isoquinolin-5-yl]benzoic acid |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)NCc1ccc(-c2cccc(C(=O)O)c2)c2ccncc12 |
| InChI | InChI=1S/C26H19F3N2O3/c27-26(28,29)20-7-4-16(5-8-20)12-24(32)31-14-19-6-9-21(22-10-11-30-15-23(19)22)17-2-1-3-18(13-17)25(33)34/h1-11,13,15H,12,14H2,(H,31,32)(H,33,34) |
| InChIKey | IAJBSADDFLUYJH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |