About 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid
3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid (PubChem CID 138503557) has the molecular formula C24H17Cl2N3O3
and a molecular weight of 466.32 g/mol. Its IUPAC name is 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid |
| PubChem CID | 138503557 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid |
| SMILES | O=C(NCc1ccc(-c2cccc(C(=O)O)c2)c2ccncc12)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl2N3O3/c25-20-5-2-6-21(22(20)26)29-24(32)28-12-16-7-8-17(18-9-10-27-13-19(16)18)14-3-1-4-15(11-14)23(30)31/h1-11,13H,12H2,(H,30,31)(H2,28,29,32) |
| InChIKey | NKGDPSHHLGLPDD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid?
The IUPAC name of 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid (CID 138503557) is 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid.
What is the SMILES notation for 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid?
The canonical SMILES for 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid is O=C(NCc1ccc(-c2cccc(C(=O)O)c2)c2ccncc12)Nc1cccc(Cl)c1Cl.
What is the InChIKey of 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid?
The InChIKey is NKGDPSHHLGLPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2N3O3/c25-20-5-2-6-21(22(20)26)29-24(32)28-12-16-7-8-17(18-9-10-27-13-19(16)18)14-3-1-4-15(11-14)23(30)31/h1-11,13H,12H2,(H,30,31)(H2,28,29,32).
What are the key properties of 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid?
3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid has a molecular weight of 466.32 g/mol, XLogP of 6.23, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[8-[[(2,3-dichlorophenyl)carbamoylamino]methyl]isoquinolin-5-yl]benzoic acid is sourced from PubChem (CID 138503557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).