About 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline
7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline (PubChem CID 138504153) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 138504153 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline |
| SMILES | O=NN1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C9H9ClN2O/c10-9-2-1-7-3-4-12(11-13)6-8(7)5-9/h1-2,5H,3-4,6H2 |
| InChIKey | BXXQQGVVGYUPCX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline (CID 138504153) is 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline is O=NN1CCc2ccc(Cl)cc2C1.
What is the InChIKey of 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline?
The InChIKey is BXXQQGVVGYUPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O/c10-9-2-1-7-3-4-12(11-13)6-8(7)5-9/h1-2,5H,3-4,6H2.
What are the key properties of 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline?
7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline has a molecular weight of 196.64 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-nitroso-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 138504153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).